Вариант цепочки Be b свойства фосфора и его соединений



Дата14.06.2020
Размер1,54 Mb.

Вариант 1

1 Цепочки

Be

B



2 Свойства фосфора и его соединений

Реакции с О2, Cl и металом, реакции с щелочью, концентрированными азотной и серной кис-ми, гидролиз Р(lll) и P(V) в водной и щелочной среде.



P4 
+5O2 изб = P4O10

+3O2 недост = P4O6


+10Cl2 изб = 4PCl5

+6Cl2 недост = 4PCl3


+6Zn = 2Zn3P спекание

+3NaOH+3H2O = PH3+3NaH2PO2

+20HNO3 к = 4HPO3+20NO2+8H2O
+10H2SO4 к = 4H3PO4+10SO2+4H2O


Pcl3+3h2o = H3PO3+3HCl
Pcl5+h2o = POCl3+2HCl
Pcl3+5koh = K2HPO3+3KCl+ 2H2O
Pcl5+8KOH = K3PO4+5KCl+4H2O

3 Манганат и перманганат

Сплавление оксида марганца с сильным окислителем

MnO2+2KOH+KNO3=K2MnO4+KNO2+H2O – получение манганата

Электролиз манганата

2K2MnO4+2H2O=2KMnO4+H2+2KOH – получение перманганата

Кисл Mn2+

Нейтр Mn4+

Щел Mn6+


2Kmno4+5k2so3+3h2so4 = 2MnSO4+6K2SO4+3H2O

2Kmno4+3k2so3+h2o = 2MnO2+3K2SO4+2KOH

2Kmno4+k2so3+2koh = 2K2MnO4+K2SO4+H2O

2Kmno4+5h2s+3h2so4 = 2MnSO4+K2SO4+5S+8H2O

2Kmno4+3h2s = 2MnO2+2KOH+3S+2H2O

2Kmno4+h2s+2koh = 2K2MnO4+S+2H2O



4 промышленное получение

Золота


Амальгамация

Ртуть способна образовывать жидкие либо твёрдые сплавы с другими металлами, которые называются амальгамой. Увлажнённую дробную породу смешивают с ртутью, а затем. Получившийся шлам промывают, извлекая амальгаму золота. Далее ртуть отгоняется из амальгамы и используется повторно с другими породами.

Цианирование

Цианирование основано на том факте, что золото растворяется в растворах синильной кислоты и её солей. Реакция золота с цианидами происходит в присутствии кислорода, содержащегося в воздухе. Данный способ включает в себя два этапа:

Обработка золотоносной породы раствором цианида натрия (менее 1%):

4Au + 8NaCN + O2+ 2H2O → 4Na[Au(CN)2] + 4NaOH;

Осаждение золота из цианоаурата натрия при помощи цинковой пыли:

2Na[Au(CN)2] + Zn → Na2[Zn(CN)4] + 2Au↓.

Борной кислоты

Бура с минеральной кислотой

Na2B4O7+H2SO4+5H2O=Na2SO4+4H3BO3

Фосфора


Фосфор в промышленности получают из фосфата кальция Ca3(PO4)2, который выделяют из фосфоритов и фторапатитов.В качестве восстановителя соединений фосфора используют кокс (углерод). Для связывания соединений кальция в реакционную систему добавляют кварцевый песок SiO2. Процесс проводят в электопечах (производство относят к электротермическим).

2Ca3(PO4)2 + 6SiO2 + 10C = 6CaSiO3 + P4 + 10CO



5 задача

Hg(NO3)2 0,001M 2л

KI 0,0001M 4л

ПР(иодид ртути)=4,0*10^(-58)

Выпадет ли осадок HgI2



Вариант 2

1 цепочки

Al



С



2 Щелочные металлы
4Na+O2 = 2Na2O

6Na+N2 = 2Na3N

2Na+H2 = 2NaH

2Na+S = Na2S

2Na+2H20 = 2NaOH+H2

3Na+HNO3разб = 3NaNO3+NO+2H2O


2Na2O2+2H2O = 4NaOH+O2

2Na2O2+2CO2 = 2Na2CO3+O2

4KO2+2H2O = 4KOH+3O2

4KO2+CO2 = 2K2CO3+3O2



3 Хромат и дихромат

Получение

2Cr2O3+KClO3+2K2CO3 = 2K2CrO4+KCl+2CO2

2Cr(OH)3+3Cl2+10KOH = 2K2CrO4+6KCl+8H2O

K2CrO4+2HClразб = K2Cr2+2KCl+H2O

K2Cr2O7+3K2SO3+4H2SO4 = Cr2(SO4)3+4K2SO4+4H2O

K2Cr2O7+3K2SO3+4H2O = 2Cr(OH)3+3K2SO4+2KOH

K2Cr2O7+3K2SO3+4KOH = 2K3CrO3+3K2SO4+2H2O

K2Cr2O7+3H2S+4H2SO4 = K2SO4+Cr2(SO4)3+3S+7H2O

K2Cr2O7+3H2S+H2O = 2Cr(OH)3+2KOH+3S

4K2Cr2O7+3H2S+6KOH = 3K2SO4 + 8KCrO2 + 6H2O

2K2Cr2O7+3C = 2Cr2O3 + 2K2CO3 + CO2

4K2CrO4+3C+10H2SO4 = 2Cr2(SO4)3 + 4K2SO4 + 3CO2 + 10H2O

4 промышленное получение

Алюминий

Глинозем получают из бокситов путем их обработки щелочью

Al2O3·nH2O + 2NaOH = 2NaAlO2 + nH2O

Полученный алюминат натрия NaAlO2 подвергают гидролизу

NaAlO2 + 2H2O = NaOH + Al(OH)3

В результате в осадок выпадают кристаллы гидрооксида алюминия Al(OH)3, который отфильтровывают, промывают и прокаливают до получения чистого глинозема (Al2O3)

Затем проводят электролиз в криолите

2Al2O3 +(Na3[AlF6])– 4Al + 3O2

Серной кислоты

4FeS2+11O2=Fe2O3+8SO2

SO2+O2=2SO3+Q

SO3+H2O=H2SO4

хлорной извести

Ca(OH)2+Cl2=CaCl2+Ca(ClO)2+H2O



5 задача

Растворимость BaCO3 = 1,58*10-4

Cs2Co3 = 0,01M

ПР - ?


Растворимость в воде - ?

Поделитесь с Вашими друзьями:


База данных защищена авторским правом ©psihdocs.ru 2019
обратиться к администрации

    Главная страница